A2855112
Isothiazolinones , mixtureofCMIandMI,2.0-2.5%inwater,PH:2.0-5.0
Synonym(s):
5-chloro-2-methyl-2h-isothiazolin-3-one/2-methyl-2h-isothiazol-3-one
CAS NO.:
Empirical Formula: C4H4ClNOS
Molecular Weight: 149.6
MDL number: MFCD00792550
EINECS: 247-500-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 10G | RMB383.20 | In Stock |
|
| 25G | RMB719.20 | In Stock |
|
| 100G | RMB1439.20 | In Stock |
|
| 500G | RMB3599.20 | In Stock |
|
| 2.5KG | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-45?C |
| Boiling point: | 109.7°C |
| Density | 1.25 (14% aq.) |
| refractive index | n |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Liquid |
| pka | -4.06±0.40(Predicted) |
| color | White |
| Odor | Pungent aromatic odor |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| Cosmetic Ingredient Review (CIR) | 5-Chloro-2-methyl-4-isothiazolin-3-one (26172-55-4) |
| InChI | InChI=1S/C4H4ClNOS/c1-6-4(7)2-3(5)8-6/h2H,1H3 |
| InChIKey | DHNRXBZYEKSXIM-UHFFFAOYSA-N |
| SMILES | S1C(Cl)=CC(=O)N1C |
| LogP | 0.240 (est) |
| CAS DataBase Reference | 26172-55-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-methyl-3(2h)-isothiazolone(26172-55-4) |
| EPA Substance Registry System | 5-Chloro-2-methyl-4-isothiazolin-3-one (26172-55-4) |
Description and Uses
Methy1chloro-isothiazolinone (MCI) is contained, along with methylisothiazolinone (MI), in Kathon cosmetic grade (CG) and MCI/MI. It is irritant and sensitizer.
Isocil(R) RW is a high performance industrial microbiocide for use in recirculating water cooling towers, wood, mold and mildew control, pulp and paper mills, air washer systems. Suggested applications: Industrial water treatment. Very low use levels.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H412 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | C,N,T,Xn |
| Risk Statements | 34-43-50-20/21/22-50/53-23/24/25-42/43 |
| Safety Statements | 26-36/37/39-45-60-61-24-28-36/37-23 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 1 |
| RTECS | NX8156850 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 3808929090 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 26172-55-4(Hazardous Substances Data) |






