A2865512
2-Cyano-phenothiazine , 98% , 38642-74-9
CAS NO.：38642-74-9
Empirical Formula: C13H8N2S
Molecular Weight: 224.28
MDL number: MFCD00792555
EINECS: 254-057-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 10g | RMB116.80 | In Stock |
|
| 25G | RMB219.20 | In Stock |
|
| 100G | RMB820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-193°C |
| Boiling point: | 427.6±34.0 °C(Predicted) |
| Density | 1.38±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Chloroform |
| form | Solid |
| pka | -3.04±0.20(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C13H8N2S/c14-8-9-5-6-13-11(7-9)15-10-3-1-2-4-12(10)16-13/h1-7,15H |
| InChIKey | XZSIGWOVDPSPMG-UHFFFAOYSA-N |
| SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC=C1C#N |
| CAS DataBase Reference | 38642-74-9(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of Cyamemazine, an antipsychotic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2934309090 |
