PRODUCT Properties
| Melting point: | 246-247℃ |
| Density | 1.149 |
| storage temp. | -15°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| Sequence | Cyclo(Ala-Gly) |
| InChI | InChI=1S/C5H8N2O2/c1-3-5(9)6-2-4(8)7-3/h3H,2H2,1H3,(H,6,9)(H,7,8)/t3-/m0/s1 |
| InChIKey | ICCHEGCKVBMSTF-VKHMYHEASA-N |
| SMILES | N1CC(=O)N[C@@H](C)C1=O |
| CAS DataBase Reference | 4526-77-6 |
Description and Uses
Cyclo(L-Ala-L-Gly) is able to cause gelation in a wide variety of organic fluids, including edible oils, glyceryl esters, alcohols, and aromatic molecules.
