A2892612
5-Chloro-2-methylpyridine , 98% , 72093-07-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB104.80 | In Stock |
|
| 5G | RMB380.80 | In Stock |
|
| 10g | RMB641.60 | In Stock |
|
| 25G | RMB1280.80 | In Stock |
|
| 100g | RMB3816.00 | In Stock |
|
| 500g | RMB12799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 163.0±0.0 °C(Predicted) |
| Density | 1.150±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid or liquid |
| pka | 3.67±0.10(Predicted) |
| Appearance | Colorless to off-white Solid-Liquid Mixture |
| InChI | InChI=1S/C6H6ClN/c1-5-2-3-6(7)4-8-5/h2-4H,1H3 |
| InChIKey | DEMKNLXJQNYAFY-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(Cl)C=C1 |
| CAS DataBase Reference | 72093-07-3(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-picoline is an organic reagent that can be used as a reaction reagent for the synthesis of alkyl-substituted pyridines via directed palladium(II)-catalyzed C-H activation of alkanoic acid amides. It has also been shown to have antitumour activity, inhibiting the growth of tumour cells, thereby preventing DNA replication and transcription.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933399990 |
