A2899112
2-Chloro-4-methyl-3-hydroxyaniline , 97% , 84540-50-1
CAS NO.:84540-50-1
Empirical Formula: C7H8ClNO
Molecular Weight: 157.6
MDL number: MFCD03094650
EINECS: 283-144-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB89.60 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 100G | RMB892.80 | In Stock |
|
| 500G | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-83°C |
| Boiling point: | 262.7±35.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| vapor pressure | 0.061-2.2Pa at 20-50℃ |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 8.89±0.15(Predicted) |
| color | White to Orange to Green |
| Cosmetics Ingredients Functions | ANTIMICROBIAL COLORANT HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 3-Amino-2-chlor-6-methylphenol (84540-50-1) |
| InChI | InChI=1S/C7H8ClNO/c1-4-2-3-5(9)6(8)7(4)10/h2-3,10H,9H2,1H3 |
| InChIKey | XYRDGCCCBJITBH-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C)C=CC(N)=C1Cl |
| LogP | 1.644 at 23℃ and pH7.27 |
| Surface tension | 63.1mN/m at 1g/L and 21℃ |
| CAS DataBase Reference | 84540-50-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36 |
| Hazard Note | Irritant |
| HS Code | 2922290090 |
| REACH Registrations | Active |




