A2909412
4-Cyanopyridine-3-boronic acid pinacol ester , 96% , 878194-91-3
CAS NO.:878194-91-3
Empirical Formula: C12H15BN2O2
Molecular Weight: 230.07
MDL number: MFCD08458478
EINECS: 201-525-2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB159.20 | In Stock |
|
| 250MG | RMB623.20 | In Stock |
|
| 1G | RMB1559.20 | In Stock |
|
| 5g | RMB5460.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-88℃ |
| Boiling point: | 365.5±27.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 1.87±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C12H15BN2O2/c1-11(2)12(3,4)17-13(16-11)10-8-15-6-5-9(10)7-14/h5-6,8H,1-4H3 |
| InChIKey | DQQFRFWEPQBNEN-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C#N)=C1B1OC(C)(C)C(C)(C)O1 |
| CAS DataBase Reference | 878194-91-3 |
Description and Uses
4-Cyanopyridine-3-boronic acid pinacol ester
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| WGK Germany | WGK 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |







