A2932012
5-Chloro-1H-indole-3-carboxylic acid , 98% , 10406-05-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB97.92 | In Stock |
|
| 1G | RMB237.60 | In Stock |
|
| 5g | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 234-235 °C |
| Boiling point: | 449.7±25.0 °C(Predicted) |
| Density | 1.548±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.69±0.30(Predicted) |
| Appearance | Off-white to brown Solid |
| InChI | InChI=1S/C9H6ClNO2/c10-5-1-2-8-6(3-5)7(4-11-8)9(12)13/h1-4,11H,(H,12,13) |
| InChIKey | XUDITEOFEQOSAK-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C(C(O)=O)=C1 |
| CAS DataBase Reference | 10406-05-0(CAS DataBase Reference) |
Description and Uses
5-Chloroindole-3-carboxylic acid is a pharmaceutical intermediate compound that can be used in the preparation of compounds and compositions for the treatment of disorders associated with sting activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2933998090 |
