A2954512
2-Cyanophenylacetic Acid , 98% , 18698-99-2
CAS NO.：18698-99-2
Empirical Formula: C9H7NO2
Molecular Weight: 161.16
MDL number: MFCD01646238
EINECS: 242-510-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB77.76 | In Stock |
|
| 5G | RMB231.20 | In Stock |
|
| 25g | RMB1007.20 | In Stock |
|
| 100g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-123℃ |
| Boiling point: | 334℃ |
| Density | 1.26 |
| Flash point: | 156℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 3.99±0.10(Predicted) |
| Appearance | Light brown to gray Solid |
| InChI | InChI=1S/C9H7NO2/c10-6-8-4-2-1-3-7(8)5-9(11)12/h1-4H,5H2,(H,11,12) |
| InChIKey | QLHZKPQKYARBGT-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1C#N |
Description and Uses
2-(2-Cyanophenyl)acetic Acid is used in preparation of tricyclic compounds as ERK inhibitors for treating cancers and autoimmune diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| HS Code | 2926907090 |
