A2959656
5-Bromo-4,6-dihydroxypyrimidine , 97% , 15726-38-2
CAS NO.：15726-38-2
Empirical Formula: C4H3BrN2O2
Molecular Weight: 190.98
MDL number: MFCD00047380
EINECS: 217-489-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 263-264 °C (decomp)(Solv: water (7732-18-5)) |
| Density | 2.25±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 3.09±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C4H3BrN2O2/c5-2-3(8)6-1-7-4(2)9/h1H,(H2,6,7,8,9) |
| InChIKey | XVXHFPZMRQXGBM-UHFFFAOYSA-N |
| SMILES | C1=NC(O)=C(Br)C(=O)N1 |
| CAS DataBase Reference | 15726-38-2(CAS DataBase Reference) |
Description and Uses
5-Bromo-4,6-dihydroxypyrimidine is mainly used as a pharmaceutical intermediate, especially in the synthesis of certain drug molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29339900 |
