A2962812
2-(4-Chloro-1H-pyrazol-1-yl)acetic acid , 98% , 32089-46-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB159.20 | In Stock |
|
| 1G | RMB355.20 | In Stock |
|
| 5g | RMB1144.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 338.9±22.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.45±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C5H5ClN2O2/c6-4-1-7-8(2-4)3-5(9)10/h1-2H,3H2,(H,9,10) |
| InChIKey | KPXIVTIAZUNIOR-UHFFFAOYSA-N |
| SMILES | N1(CC(O)=O)C=C(Cl)C=N1 |
Description and Uses
(4-Chloro-1H-pyrazol-1-yl)acetic Acid is used to prepare bicyclic compounds for reduction of β-amyloid peptide production.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |







