A2963212
2-Chloro-6-methoxybenzoic acid , 96% , 3260-89-7
CAS NO.：3260-89-7
Empirical Formula: C8H7ClO3
Molecular Weight: 186.59
MDL number: MFCD00127702
EINECS: 221-863-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB48.24 | In Stock |
|
| 250MG | RMB97.60 | In Stock |
|
| 1g | RMB197.60 | In Stock |
|
| 5g | RMB724.00 | In Stock |
|
| 10g | RMB1260.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141 °C |
| Boiling point: | 304.6±22.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 2.87±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C8H7ClO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | JUOHBAJZQDTICO-UHFFFAOYSA-N |
| SMILES | ClC1=C(C(O)=O)C(OC)=CC=C1 |
Description and Uses
2-chloro-6-methoxybenzoic acid can be used as a versatile intermediate in the synthesis of various organic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2918999090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
