A2992812
2-(Chloromethyl)benzoic acid , 95% , 85888-81-9
Synonym(s):
α-Chloro-o-toluic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB62.40 | In Stock |
|
| 1G | RMB160.80 | In Stock |
|
| 5g | RMB508.00 | In Stock |
|
| 25g | RMB1580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-135.5 °C |
| Boiling point: | 305.7±17.0 °C(Predicted) |
| Density | 1.315±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | crystalline needles |
| pka | 3.73±0.36(Predicted) |
| color | Colourless to white crystals |
| BRN | 1940772 |
| InChI | InChI=1S/C8H7ClO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | YTEUDCIEJDRJTM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1CCl |
| CAS DataBase Reference | 85888-81-9(CAS DataBase Reference) |
Description and Uses
2-Chloromethylbenzoic Acid acts as a reagent for the synthesis of (azolyl)methyl)arylbenzamides as dual inhibitors of VEGFR-1/2 kinases.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 2916399090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |





