A3098612
Dinitrodiammineplatinum ammoniacal , 59% , 14286-02-3
CAS NO.:14286-02-3
Empirical Formula: H6N4O4Pt
Molecular Weight: 321.15
MDL number: MFCD00011622
EINECS: 238-203-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB168.80 | In Stock |
|
| 1G | RMB589.60 | In Stock |
|
| 5G | RMB2287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.015 g/mL at 25 °C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | liquid |
| color | colorless to light yellow |
| InChI | InChI=1S/2NO2.2H2N.Pt/c2*2-1-3;;;/h;;2*1H2;/q4*-1;+4 |
| InChIKey | FAOUENTVTAXLPG-UHFFFAOYSA-L |
| SMILES | [Pt+2](N)(N)([N-](=O)=O)[N-](=O)=O |
| EPA Substance Registry System | Platinum, diamminebis(nitrito-.kappa.N)- (14286-02-3) |
Description and Uses
Diamminedinitritoplatinum(II) is an active precursor, extensively used in the preparation of Pt-based catalysts on supports such as carbon black and graphene nanosheets. Diamminedinitritoplatinum(II) solution can be used as a platinum source in the synthesis of CoXPt1-X alloy nanowires.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H335-H410 |
| Precautionary statements | P261-P271-P273-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,N |
| Risk Statements | 42/43-46-61-50-36/37/38 |
| Safety Statements | 23-36-43-45-61-26 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B STOT SE 3 |








