A3099012
3,4-Dimethoxycinnamic acid , 99% , 2316-26-9
Synonym(s):
Caffeic acid dimethyl ether
CAS NO.：2316-26-9
Empirical Formula: C11H12O4
Molecular Weight: 208.21
MDL number: MFCD00004387
EINECS: 219-025-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB60.80 | In Stock |
|
| 100G | RMB204.80 | In Stock |
|
| 500g | RMB911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183 °C(lit.) |
| Boiling point: | 267.4°C (rough estimate) |
| Density | 1.0627 (rough estimate) |
| refractive index | 1.4389 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in hot methanol, very faint turbidity. Soluble in dichloromethane, chloroform. |
| pka | 4.53±0.10(Predicted) |
| form | Powder |
| color | Slightly yellow to light beige |
| BRN | 1533435 |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13) |
| InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C(OC)=C1 |
| LogP | 2.340 |
| CAS DataBase Reference | 2316-26-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dimethoxycinnamic acid(2316-26-9) |
Description and Uses
3,4-Dimethoxycinnamic Acid is a Cinnamic Acid (C442030) derivative,used in the synthesis of amides and esters through coupling reactions involving carboxylic acids and amines and N-methylation of amides and O-methylation of carboxylic acids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
