A3100412
2,6-Dichlorobenzyl chloride , 98% , 2014-83-7
Synonym(s):
α,2,6-Trichlorotoluene
CAS NO.:2014-83-7
Empirical Formula: C7H5Cl3
Molecular Weight: 195.47
MDL number: MFCD00000897
EINECS: 217-940-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500G | RMB1006.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-39 °C (lit.) |
| Boiling point: | 117-119 °C/14 mmHg (lit.) |
| Density | 1.386±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | methanol: 0.1 g/mL, clear |
| form | Solid |
| color | White or Colorless to Almost white or Almost colorless |
| BRN | 472282 |
| InChI | InChI=1S/C7H5Cl3/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | LBOBESSDSGODDD-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(Cl)=C1CCl |
| CAS DataBase Reference | 2014-83-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-dichloro-2-(chloromethyl)-(2014-83-7) |
| EPA Substance Registry System | Benzene, 1,3-dichloro-2-(chloromethyl)- (2014-83-7) |
Description and Uses
α,2,6-Trichloro-toluene (Isoconazole Impurity 2) is an impurity of Isoconazole, an antibacterial agent used to treat tinea inguinalis infections.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



