A3100612
2,4-Dichlorobenzonitrile , 98% , 6574-98-7
Synonym(s):
2,4-Dichlorobenzonitrile
CAS NO.：6574-98-7
Empirical Formula: C7H3Cl2N
Molecular Weight: 172.01
MDL number: MFCD00016373
EINECS: 229-493-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB225.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-61 °C |
| Boiling point: | 125 °C / 15mmHg |
| Density | 1.4980 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | soluble in Methanol |
| form | Solid:bulk |
| color | White to Almost white |
| Water Solubility | insoluble |
| BRN | 637738 |
| InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | GRUHREVRSOOQJG-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 6574-98-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Dichlorobenzonitrile(6574-98-7) |
Description and Uses
Used as intermediate for the synthesis of agrochemicals, pharmaceuticals and chemical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-36-36/37-9 |
| RIDADR | 3276 |
| WGK Germany | WGK 2 water endangering |
| Hazard Note | Irritant/Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
