A3101512
3,5-Dinitrobenzoyl chloride , 99%, used for HPLC derivative marks , 99-33-2
Synonym(s):
3,5-Dinitrobenzoic acid chloride;DNBC;NSC 2697
CAS NO.:99-33-2
Empirical Formula: C7H3ClN2O5
Molecular Weight: 230.56
MDL number: MFCD00007248
EINECS: 202-750-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-69 °C(lit.) |
| Boiling point: | 196 °C11 mm Hg(lit.) |
| Density | 1.8836 (rough estimate) |
| vapor density | 7.6 (vs air) |
| refractive index | 1.6290 (estimate) |
| Flash point: | 196°C/12mm |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystals or Crystalline Needles |
| color | Yellow to beige |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,3277 |
| BRN | 990249 |
| Stability: | Stable. Incompatible with strong oxidizing agents, water, moisture, nitrates, combustible material. Refrigerate. |
| InChI | 1S/C7H3ClN2O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H |
| InChIKey | NNOHXABAQAGKRZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(cc(c1)[N+]([O-])=O)C(Cl)=O |
| CAS DataBase Reference | 99-33-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 3,5-dinitro-(99-33-2) |
| EPA Substance Registry System | Benzoyl chloride, 3,5-dinitro- (99-33-2) |
Description and Uses
Used in photography. This aromatic compound is used by chemists to identify alcohol components in esters and in the fluorometric analysis of creatinine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6637000 |
| F | 21 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| HS Code | 29400090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




