A3102412
3,5-Difluorophenylboronic acid , 98% , 156545-07-2
Synonym(s):
(3,5-Difluorophenyl)dihydroxyborane;3,5-Difluorobenzeneboronic acid
CAS NO.:156545-07-2
Empirical Formula: C6H5BF2O2
Molecular Weight: 157.91
MDL number: MFCD01318138
EINECS: 605-060-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100G | RMB455.20 | In Stock |
|
| 500g | RMB1813.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-217 °C (lit.) |
| Boiling point: | 266.9±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder |
| pka | 6.46±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 6800882 |
| InChI | InChI=1S/C6H5BF2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| InChIKey | QWQBQRYFWNIDOC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(F)=CC(F)=C1)(O)O |
| CAS DataBase Reference | 156545-07-2(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-20-19-11-22 |
| Safety Statements | 26-36-33-16-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






