A3103012
2,3-Dibromothiophene , 98% , 3140-93-0
CAS NO.:3140-93-0
Empirical Formula: C4H2Br2S
Molecular Weight: 241.93
MDL number: MFCD00005418
EINECS: 221-542-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -17.5°C |
| Boiling point: | 218-219 °C (lit.) |
| Density | 2.137 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | liquid |
| Specific Gravity | 2.137 |
| color | White to Yellow to Green |
| Sensitive | Light Sensitive |
| BRN | 107512 |
| InChI | InChI=1S/C4H2Br2S/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | ATRJNSFQBYKFSM-UHFFFAOYSA-N |
| SMILES | C1(Br)SC=CC=1Br |
| CAS DataBase Reference | 3140-93-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Thiophene, 2,3-dibromo-(3140-93-0) |
Description and Uses
2,3-Dibromothiophene (cas# 3140-93-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H301-H319 |
| Precautionary statements | P210-P301+P310+P330-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,F,Xi,T |
| Risk Statements | 10-36/37/38-20/21/22-36-25 |
| Safety Statements | 23-24/25-36/37/39-26-16-36-45 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







![(1α,2β,4β,5α)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7α-ol](https://img.chemicalbook.com/CAS/20180808/GIF/498-46-4.gif)
