A3103812
Dienestrol , Analysis standard , 84-17-3
Synonym(s):
3,4-Bis(4-hydroxyphenyl)-2,4-hexadiene
CAS NO.:84-17-3
Empirical Formula: C18H18O2
Molecular Weight: 266.33
MDL number: MFCD00050983
EINECS: 201-519-7
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB315.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229 °C |
| Boiling point: | 349.54°C (rough estimate) |
| Density | 1.184 g/cm3 |
| refractive index | 1.4800 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 9.21±0.15(Predicted) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| Water Solubility | 3mg/L(37 ºC) |
| Merck | 3104 |
| BRN | 2053694 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H18O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3-12,19-20H,1-2H3/b17-3+,18-4+ |
| InChIKey | NFDFQCUYFHCNBW-SCGPFSFSSA-N |
| SMILES | C\C=C(c1ccc(O)cc1)\C(=C\C)c2ccc(O)cc2 |
| CAS DataBase Reference | 84-17-3 |
| EPA Substance Registry System | Dienestrol (84-17-3) |
Description and Uses
Medicine (estrogenic hormone).
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350-H361d |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn,T |
| Risk Statements | 40-48-62-45 |
| Safety Statements | 22-24/25-45-36/37-53 |
| WGK Germany | 3 |
| RTECS | SL0580000 |
| HS Code | 2907.29.0500 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Repr. 2 |
| Hazardous Substances Data | 84-17-3(Hazardous Substances Data) |




