PRODUCT Properties
| Melting point: | -50 °C (lit.) |
| Boiling point: | 84-87 °C (lit.) |
| Density | 0.757 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | −18 °F |
| storage temp. | 2-8°C, sealed storage, away from moisture and light |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 10.80±0.10(Predicted) |
| form | Oil |
| color | Colourless |
| BRN | 635656 |
| Henry's Law Constant | 4.0×10-1 mol/(m3Pa) at 25℃, Yaws (2003) |
| InChI | InChI=1S/C5H13N/c1-4(2)5(3)6/h4-5H,6H2,1-3H3 |
| InChIKey | JOZZAIIGWFLONA-UHFFFAOYSA-N |
| SMILES | CC(N)C(C)C |
| CAS DataBase Reference | 598-74-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butanamine, 3-methyl-(598-74-3) |
| EPA Substance Registry System | 3-Methyl-2-butanamine (598-74-3) |
Description and Uses
1,2-Dimethylpropylamine was used as standard in separation of alkali and alkaline earth metal cations by capillary electrochromatography on monolithic octadecylsilica columns.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H225-H302-H311-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-21/22-34 |
| Safety Statements | 16-26-27-36/37/39-45 |
| RIDADR | UN 3286 3/PG 2 |
| WGK Germany | 3 |
| RTECS | UI1100000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 2921199990 |
| Toxicity | LD50 ipr-mus: 279 mg/kg JJPAAZ 17,475,67 |
