A3112512
Dibenzothiophene sulfone , 97% , 1016-05-3
CAS NO.:1016-05-3
Empirical Formula: C12H8O2S
Molecular Weight: 216.26
MDL number: MFCD00004970
EINECS: 213-805-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB53.60 | In Stock |
|
| 5G | RMB126.40 | In Stock |
|
| 25G | RMB430.40 | In Stock |
|
| 100g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-233 °C (lit.) |
| Boiling point: | 326.68°C (rough estimate) |
| Density | 1.2983 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H8O2S/c13-15(14)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H |
| InChIKey | IKJFYINYNJYDTA-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1C1=CC=CC=C1S2(=O)=O |
| CAS DataBase Reference | 1016-05-3(CAS DataBase Reference) |
| EPA Substance Registry System | Dibenzothiophene 5,5-dioxide (1016-05-3) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |





