A3114612
2,4-Dichloro-3,5-dinitrobenzotrifluoride , 97% , 29091-09-6
CAS NO.:29091-09-6
Empirical Formula: C7HCl2F3N2O4
Molecular Weight: 304.99
MDL number: MFCD00042480
EINECS: 249-420-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 100g | RMB230.40 | In Stock |
|
| 500g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78°C |
| Boiling point: | 291-294°C |
| Density | 1.788±0.06 g/cm3(Predicted) |
| vapor pressure | 0.113Pa at 25℃ |
| Flash point: | >110°C |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Light Yellow |
| BRN | 2062037 |
| InChI | InChI=1S/C7HCl2F3N2O4/c8-4-2(7(10,11)12)1-3(13(15)16)5(9)6(4)14(17)18/h1H |
| InChIKey | DPQYRXNRGNLPFC-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC(C(F)(F)F)=C(Cl)C([N+]([O-])=O)=C1Cl |
| LogP | 3.88 |
| CAS DataBase Reference | 29091-09-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Dichloro-3,5-dinitrobenzotrifluoride (29091-09-6) |
Description and Uses
2,4-Dichloro-3,5-dinitrobenzotrifluoride is a reagent used in the synthesis of kinesin spindle protein inhibitors. Potential use as an alternative to neurotoxic MT inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H400-H410 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 20/21/22-36/37/38-22-50/53 |
| Safety Statements | 26-36/37/39-57-36/37 |
| RIDADR | 2811 |
| Hazard Note | Irritant/Harmful |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |




