A3116812
1,2-Dibromobutane , 98% , 533-98-2
CAS NO.:533-98-2
Empirical Formula: C4H8Br2
Molecular Weight: 215.91
MDL number: MFCD00000157
EINECS: 208-581-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| 250g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -65°C |
| Boiling point: | 59-60 °C/20 mmHg (lit.) |
| Density | 1.789 g/mL at 25 °C (lit.) |
| refractive index | 1.513-1.515 |
| Flash point: | >110°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | alcohol: miscible(lit.) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Merck | 14,1566 |
| BRN | 1731380 |
| InChI | InChI=1S/C4H8Br2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
| InChIKey | CZWSZZHGSNZRMW-UHFFFAOYSA-N |
| SMILES | C(Br)C(Br)CC |
| CAS DataBase Reference | 533-98-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Butane, 1,2-dibromo-(533-98-2) |
| EPA Substance Registry System | Butane, 1,2-dibromo- (533-98-2) |
Description and Uses
Mechanism of Co(II) (N,N′-disalicylidene-ethylenediamine) catalyzed reduction of 1,2-dibromobutane in DMF has been investigated by microelectrode voltammetry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-36/37/38-20/21/22 |
| Safety Statements | 37/39-26 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29033919 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







