A3117312
N,N-Diglycidyl-4-glycidyloxyaniline , 90% , 5026-74-4
Synonym(s):
N ,N ,o -Triglycidyl-p -aminophenol;p -(Diglycidylamino)phenyl glycidyl ether;4-(Diglycidylamino)phenyl glycidyl ether;4-Glycidyloxy-N ,N -diglycidylaniline
CAS NO.:5026-74-4
Empirical Formula: C15H19NO4
Molecular Weight: 277.32
MDL number: MFCD00192036
EINECS: 225-716-2
| Pack Size | Price | Stock | Quantity |
| 50ML | RMB159.20 | In Stock |
|
| 250ML | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 420.18°C (rough estimate) |
| Density | 1.22 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 4.78±0.50(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | 3.34g/L at 20℃ |
| InChI | InChI=1S/C15H19NO4/c1-3-12(17-9-15-10-20-15)4-2-11(1)16(5-13-7-18-13)6-14-8-19-14/h1-4,13-15H,5-10H2 |
| InChIKey | AHIPJALLQVEEQF-UHFFFAOYSA-N |
| SMILES | O1CC1CN(C1=CC=C(OCC2CO2)C=C1)CC1CO1 |
| LogP | 0.871 |
| CAS DataBase Reference | 5026-74-4(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N,N-Glycidyl p-aminophenol(5026-74-4) |
| EPA Substance Registry System | 4-(Diglycidylamino)phenyl glycidyl ether (5026-74-4) |
Description and Uses
N,N-Diglycidyl-4-glycidyloxyaniline can be used:
- As a precursor to synthesize rigid-flexible epoxy shape memory polymers through thiol-epoxy click-reaction. It helps to enhance the mechanical properties of the epoxy material.
- As a cross linker to synthesize high molecular weight redox polymer to fabricate electrochemical sensors for glucose monitoring devices.
- As a precursor to synthesize amine sorbent pellets for CO2 capture.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H341-H373-H411 |
| Precautionary statements | P201-P273-P280-P301+P312+P330-P302+P352-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-40-43 |
| Safety Statements | 23-26-36 |
| WGK Germany | 2 |
| RTECS | RR0504000 |
| TSCA | TSCA listed |
| HS Code | 29221990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Muta. 2 Skin Sens. 1 STOT RE 2 |
| Toxicity | LD50 oral in hamster: 2739mg/kg |






