A3118412
1,5-Difluoro-2,4-dinitrobenzene , 97% , 327-92-4
Synonym(s):
DFDNB
CAS NO.:327-92-4
Empirical Formula: C6H2F2N2O4
Molecular Weight: 204.09
MDL number: MFCD00007052
EINECS: 206-324-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB211.20 | In Stock |
|
| 100G | RMB679.20 | In Stock |
|
| 500g | RMB2805.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-74 °C (lit.) |
| Boiling point: | 306.8±37.0 °C(Predicted) |
| Density | 1.6930 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | insoluble |
| BRN | 1883116 |
| InChI | 1S/C6H2F2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H |
| InChIKey | VILFTWLXLYIEMV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(c(F)cc1F)[N+]([O-])=O |
| CAS DataBase Reference | 327-92-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-difluoro-4,6-dinitro-(327-92-4) |
| EPA Substance Registry System | Benzene, 1,5-difluoro-2,4-dinitro- (327-92-4) |
Description and Uses
1,5-Difluoro-2,4-dinitrobenzene acts as an oleanolic acid NO-releasing derivative used towards the treatment of colon cancer. Also used in the synthesis of beta blockers used as bronchodialators.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H311+H331-H373 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-33-38 |
| Safety Statements | 36/37/39-45-36/37-28A-28 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | CZ5663200 |
| F | 10-21 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049085 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 3 Dermal Acute Tox. 3 Inhalation STOT RE 2 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |






