A3118612
3,4-Dimethyldiphenylamine , 98% , 17802-36-7
CAS NO.:17802-36-7
Empirical Formula: C14H15N
Molecular Weight: 197.28
MDL number: MFCD03093248
EINECS: 679-857-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57°C |
| Boiling point: | 333.3±11.0 °C(Predicted) |
| Density | 1.049±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 1.42±0.50(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C14H15N/c1-11-8-9-14(10-12(11)2)15-13-6-4-3-5-7-13/h3-10,15H,1-2H3 |
| InChIKey | ACWJKFBBRPYPLL-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(C)C(C)=C1 |
| CAS DataBase Reference | 17802-36-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2921490090 |







