A3118912
4-(Di-p-tolylamino)benzaldehyde , 98% , 42906-19-4
CAS NO.：42906-19-4
Empirical Formula: C21H19NO
Molecular Weight: 301.38
MDL number: MFCD03093257
EINECS: 255-996-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB1175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109 °C |
| Boiling point: | 470.5±45.0 °C(Predicted) |
| Density | 1.138±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | almost transparency in hot Acetonitrile |
| form | powder to crystal |
| pka | -4.76±0.50(Predicted) |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C21H19NO/c1-16-3-9-19(10-4-16)22(20-11-5-17(2)6-12-20)21-13-7-18(15-23)8-14-21/h3-15H,1-2H3 |
| InChIKey | XCGLXUJEPIVZJM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N(C2=CC=C(C)C=C2)C2=CC=C(C)C=C2)C=C1 |
| CAS DataBase Reference | 42906-19-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 4-[bis(4-methylphenyl)amino]- (42906-19-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2922.39.4500 |
