A3123012
O-(2-Oxo-1(2H)pyridyl)-N,N,N′,N′-tetramethyluronium tetrafluoroborate , 98% , 125700-71-2
Synonym(s):
O-(1,2-Dihydro-2-oxo-1-pyridyl)-N,N,N′-N′-tetramethyluronium tetrafluoroborate;TPTU
CAS NO.：125700-71-2
Empirical Formula: C10H16N3O2.BF4
Molecular Weight: 297.06
MDL number: MFCD00075475
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB247.20 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H16N3O2.BF4/c1-11(2)10(12(3)4)15-13-8-6-5-7-9(13)14;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1 |
| InChIKey | HBQDCKPPSIWZLY-UHFFFAOYSA-M |
| SMILES | N1(C=CC=CC1=O)O/C(=[N+](/C)\C)/N(C)C.[B-](F)(F)(F)F |
| CAS DataBase Reference | 125700-71-2(CAS DataBase Reference) |
Description and Uses
Reagent for:
Amidation
Peptide Coupling
Esterification of nucleosides to solid phase supports for oligonucleoside synthesis
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335-H302-H314 |
| Precautionary statements | P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P261-P280a-P304+P340-P305+P351+P338-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 37-36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-37/39-24/25 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Sens. 1A |
