A3123112
2,3-Dimethoxybenzoic acid , 99% , 1521-38-6
CAS NO.:1521-38-6
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00002432
EINECS: 216-188-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB219.20 | In Stock |
|
| 500g | RMB836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-122 °C (lit.) |
| Boiling point: | 275.56°C (rough estimate) |
| Density | 1.2481 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 5.310g/l slightly soluble |
| pka | 3.97±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Light beige |
| Water Solubility | slightly soluble |
| BRN | 2210858 |
| InChI | InChI=1S/C9H10O4/c1-12-7-5-3-4-6(9(10)11)8(7)13-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | FODBVCSYJKNBLO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(OC)=C1OC |
| LogP | 0.907 (est) |
| CAS DataBase Reference | 1521-38-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3-Dimethoxybenzoic acid(1521-38-6) |
Description and Uses
2,3-Dimethoxybenzoic acid is widely used as an intermediate in organic synthesis, its methoxy-substituted aromatic ring enables selective functionalization, making it useful in the preparation of more complex aromatic and heterocyclic derivatives. In addition, it is applied in material science research for the development of functionalized polymers and organic electronic materials, where its structural and electronic properties can influence conductivity, stability, and overall material performance.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280g-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | DG8598700 |
| Hazard Note | Irritant |
| HS Code | 29189090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,> 800mg/kg (800mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 196, Pg. 478, 1976. |






