A3124112
4,6-Dichloro-2-methylpyrimidine , 98% , 1780-26-3
CAS NO.:1780-26-3
Empirical Formula: C5H4Cl2N2
Molecular Weight: 163
MDL number: MFCD00090472
EINECS: 605-815-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB76.80 | In Stock |
|
| 100G | RMB216.00 | In Stock |
|
| 500G | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41.5-45.5 °C (lit.) |
| Boiling point: | 210.8±20.0 °C(Predicted) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| Flash point: | 208 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | -3.84±0.30(Predicted) |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| InChI | InChI=1S/C5H4Cl2N2/c1-3-8-4(6)2-5(7)9-3/h2H,1H3 |
| InChIKey | FIMUTBLUWQGTIJ-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(Cl)=CC(Cl)=N1 |
| CAS DataBase Reference | 1780-26-3(CAS DataBase Reference) |
Description and Uses
4,6-Dichloro-2-methylpyrimidine, is a versatile building block used for the synthesis of more complex pharmaceutical and biologically active compounds, such as Dasatinib (D290002), and its derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H411 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,N,Xn |
| Risk Statements | 34-51/53-43-22 |
| Safety Statements | 26-36/37/39-45-61-36/37 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Skin Sens. 1 |




![4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine](https://img.chemicalbook.com/CAS/GIF/42754-96-1.gif)


