A3126312
Dipentyl phthalate , 98% , 131-18-0
CAS NO.:131-18-0
Empirical Formula: C18H26O4
Molecular Weight: 306.4
MDL number: MFCD00041934
EINECS: 205-017-9
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB227.20 | In Stock |
|
| 100ML | RMB799.20 | In Stock |
|
| 500ML | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -55 °C |
| Boiling point: | 342 °C |
| Density | 1.025 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >110°C |
| storage temp. | room temp |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Odor | Mild, pleasant. |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1987323 |
| Major Application | environmental |
| InChI | 1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | IPKKHRVROFYTEK-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)c1ccccc1C(=O)OCCCCC |
| CAS DataBase Reference | 131-18-0(CAS DataBase Reference) |
| EPA Substance Registry System | Dipentyl phthalate (131-18-0) |
Description and Uses
Di-n-pentyl phthalate is a colorless oily liquid. Sp.Gr. 1.02. B.P. approximately 350℃. Insoluble in water.
Di-n-pentyl phthalate is a plasticizer for PVC membrane electrodes.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360-H400 |
| Precautionary statements | P201-P273-P308+P313 |
| Hazard Codes | T,N |
| Risk Statements | 60-61-50 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | TI1930000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173490 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Repr. 1B |
| Hazardous Substances Data | 131-18-0(Hazardous Substances Data) |




