A3126812
Dibutyl maleate , 97% , 105-76-0
Synonym(s):
Maleic acid dibutyl ester
CAS NO.:105-76-0
Empirical Formula: C12H20O4
Molecular Weight: 228.28
MDL number: MFCD00009447
EINECS: 203-328-4
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB29.60 | In Stock |
|
| 500ML | RMB84.00 | In Stock |
|
| 2.5L | RMB399.20 | In Stock |
|
| 10L | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -85°C |
| Boiling point: | 281 °C(lit.) |
| Density | 0.988 g/mL at 25 °C(lit.) |
| Pour Point | -85 |
| vapor pressure | 0.0027 hPa (20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.17g/l slightly soluble |
| form | Liquid |
| color | Clear colorless to light yellow |
| explosive limit | 0.5-3.4%(V) |
| Water Solubility | insoluble |
| FreezingPoint | <-85℃ |
| BRN | 1726634 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7- |
| InChIKey | JBSLOWBPDRZSMB-FPLPWBNLSA-N |
| SMILES | [H]\C(=C(/[H])C(=O)OCCCC)C(=O)OCCCC |
| LogP | 3.39 at 25℃ |
| CAS DataBase Reference | 105-76-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butenedioic acid (Z)-, dibutyl ester(105-76-0) |
| EPA Substance Registry System | Dibutyl maleate (105-76-0) |
Description and Uses
Dibutyl Maleate is a reagent used in the preparation of lactones for the synthesis of antibacterial compounds.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H373-H411 |
| Precautionary statements | P260-P272-P273-P280-P302+P352-P314 |
| target organs | Kidney |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-43-48/22 |
| Safety Statements | 26-36-61-37-29-24-36/37 |
| WGK Germany | 1 |
| RTECS | ON0875000 |
| Autoignition Temperature | 280 °C |
| TSCA | TSCA listed |
| HS Code | 29171990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Sens. 1 STOT RE 2 Oral |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg LD50 dermal Rabbit 10039 mg/kg |







