A3128812
2,6-Dichlorobenzoyl chloride , 98% , 4659-45-4
CAS NO.:4659-45-4
Empirical Formula: C7H3Cl3O
Molecular Weight: 209.46
MDL number: MFCD00000662
EINECS: 225-102-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB110.40 | In Stock |
|
| 100G | RMB300.00 | In Stock |
|
| 250g | RMB594.40 | In Stock |
|
| 500g | RMB1174.40 | In Stock |
|
| 1kg | RMB2231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15-17 °C |
| Boiling point: | 142-143 °C/21 mmHg (lit.) |
| Density | 1.462 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| color | Clear colorless to light yellow or light pink |
| Water Solubility | Miscible with alcohol, ether and acetone. Slightly miscible with heptane. Immiscible with water. |
| Sensitive | Moisture Sensitive |
| BRN | 639531 |
| InChI | InChI=1S/C7H3Cl3O/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H |
| InChIKey | JBLIDPPHFGWTKU-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=C(Cl)C=CC=C1Cl |
| CAS DataBase Reference | 4659-45-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Dichlorobenzoyl chloride(4659-45-4) |
Description and Uses
2,6-Dichlorobenzoyl chloride was used:
- in substrate activity screening method for the rapid development of novel substrates and their conversion into non-peptidic inhibitors of Cys and Ser proteases
- in the synthesis of 1-acyliridoles
- in enantiocontrolled total synthesis of (-)-aspicilin
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 1 |
| F | 10-19-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



