A3129212
2,5-Dimethoxyphenylboronic acid , 98% , 107099-99-0
Synonym(s):
2,5-Dimethoxybenzeneboronic acid
CAS NO.:107099-99-0
Empirical Formula: C8H11BO4
Molecular Weight: 181.98
MDL number: MFCD01318181
EINECS: 679-699-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB257.60 | In Stock |
|
| 100g | RMB879.20 | In Stock |
|
| 500g | RMB4079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C (lit.) |
| Boiling point: | 374.5±52.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | solid |
| pka | 8.12±0.58(Predicted) |
| color | White to Light yellow |
| BRN | 2969872 |
| InChI | InChI=1S/C8H11BO4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5,10-11H,1-2H3 |
| InChIKey | QOZLFNQLIKOGDR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(OC)=CC=C1OC)(O)O |
| CAS DataBase Reference | 107099-99-0(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36/37-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |






