A3132112
2,3-Difluorophenylboronic acid , 98% , 121219-16-7
Synonym(s):
2,3-Difluorobenzeneboronic acid
CAS NO.:121219-16-7
Empirical Formula: C6H5BF2O2
Molecular Weight: 157.91
MDL number: MFCD01863170
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB241.60 | In Stock |
|
| 100G | RMB764.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95 °C (dec.) (lit.) |
| Boiling point: | 274.8±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 7.29±0.58(Predicted) |
| color | White to light beige |
| BRN | 6594341 |
| InChI | InChI=1S/C6H5BF2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,10-11H |
| InChIKey | SZYXKFKWFYUOGZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(F)=C1F)(O)O |
| CAS DataBase Reference | 121219-16-7(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




