A3132212
2,4-Difluorophenylboronic acid , 98% , 144025-03-6
Synonym(s):
2,4-Difluorobenzeneboronic acid
CAS NO.:144025-03-6
Empirical Formula: C6H5BF2O2
Molecular Weight: 157.91
MDL number: MFCD01318998
EINECS: 604-390-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-250 °C (lit.) |
| Boiling point: | 251.0±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 8.47±0.58(Predicted) |
| color | Off-white to light beige or yellow |
| BRN | 8616257 |
| InChI | InChI=1S/C6H5BF2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| InChIKey | QQLRSCZSKQTFGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(F)C=C1F)(O)O |
| CAS DataBase Reference | 144025-03-6(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






