A3137112
2,4-Dinitrobenzaldehyde , 97% , 528-75-6
CAS NO.：528-75-6
Empirical Formula: C7H4N2O5
Molecular Weight: 196.12
MDL number: MFCD00013376
EINECS: 208-440-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB202.40 | In Stock |
|
| 100G | RMB685.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-70 °C (lit.) |
| Boiling point: | 190 °C/10 mmHg (lit.) |
| Density | 1.6665 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | 190°C/10mm |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Light Brown to Light Red |
| Sensitive | Air Sensitive |
| Merck | 14,3272 |
| BRN | 1878706 |
| InChI | InChI=1S/C7H4N2O5/c10-4-5-1-2-6(8(11)12)3-7(5)9(13)14/h1-4H |
| InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 528-75-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Dinitrobenzaldehyde(528-75-6) |
Description and Uses
2,4-Dinitrobenzaldehyde is a reagent used in the preparation of Schiff bases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | CU5957000 |
| Hazard Note | Irritant |
| HS Code | 29124990 |
