A3142212
2,4-Dichloro-5-sulfamoylbenzoic Acid , 98% , 2736-23-4
CAS NO.：2736-23-4
Empirical Formula: C7H5Cl2NO4S
Molecular Weight: 270.09
MDL number: MFCD00007931
EINECS: 220-358-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25g | RMB49.60 | In Stock |
|
| 50G | RMB63.20 | In Stock |
|
| 100g | RMB121.60 | In Stock |
|
| 250G | RMB295.20 | In Stock |
|
| 1KG | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-232 °C (dec.)(lit.) |
| Boiling point: | 503.8±60.0 °C(Predicted) |
| Density | 1.5426 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 2.08±0.25(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | insoluble |
| InChI | InChI=1S/C7H5Cl2NO4S/c8-4-2-5(9)6(15(10,13)14)1-3(4)7(11)12/h1-2H,(H,11,12)(H2,10,13,14) |
| InChIKey | ZSHHRBYVHTVRFK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1Cl |
| CAS DataBase Reference | 2736-23-4(CAS DataBase Reference) |
Description and Uses
2,4-Dichloro-5-sulfamoylbenzoic Acid is a chlorinated sulfamoylbenzoic acid with diuretic acid.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H303-H335-H315-H318 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P310-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG8100000 |
| HS Code | 29350090 |
| Toxicity | mouse,LD50,intraperitoneal,15gm/kg (15000mg/kg),Pharmaceutical Chemistry Journal Vol. 19, Pg. 697, 1985. |
