A3143512
Dibutyltin maleate , 95% , 78-04-6
CAS NO.:78-04-6
Empirical Formula: C12H20O4Sn
Molecular Weight: 346.99
MDL number: MFCD00014120
EINECS: 201-077-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB79.20 | In Stock |
|
| 250g | RMB159.20 | In Stock |
|
| 500G | RMB263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-140 °C(lit.) |
| Boiling point: | 324.1±25.0 °C(Predicted) |
| Density | 1,318 g/cm3 |
| refractive index | 1.502 |
| Flash point: | 204°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| Specific Gravity | 1.318 |
| color | Light yellow to Yellow to Orange |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| InChI | InChI=1S/C4H4O4.2C4H9.Sn/c5-3(6)1-2-4(7)8;2*1-3-4-2;/h1-2H,(H,5,6)(H,7,8);2*1,3-4H2,2H3;/q;;;+2/p-2/b2-1-;;; |
| InChIKey | ZBBLRPRYYSJUCZ-GRHBHMESSA-L |
| SMILES | O1C(=O)C=CC(=O)O[Sn]1(CCCC)CCCC |
| CAS DataBase Reference | 78-04-6(CAS DataBase Reference) |
| EPA Substance Registry System | Dibutyltin maleate (78-04-6) |
Description and Uses
PVC Stabilizer, condensation catalyst
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317-H330-H341-H360-H372-H411 |
| Precautionary statements | P201-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N,T |
| Risk Statements | 24/25-26-36/37/38-50/53-68-48/25-43-34-23-22-61-60 |
| Safety Statements | 26-28-36/37-45-60-61-36/37/39-22 |
| RIDADR | UN 3146 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | JH4735000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 2 Repr. 1B Skin Corr. 1B Skin Sens. 1 STOT RE 1 |
| Toxicity | LDLo oral in mouse: 470mg/kg |







