A3147212
2,4-Dichlorophenoxyacetic acid , 98% , 2702-72-9
Synonym(s):
2,4-D sodium salt monohydrate;Sodium 2,4-dichlorophenoxyacetate monohydrate
CAS NO.:2702-72-9
Empirical Formula: C8H5Cl2NaO3
Molecular Weight: 243.02
MDL number: MFCD00068284
EINECS: 220-290-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB52.80 | In Stock |
|
| 100G | RMB148.88 | In Stock |
|
| 500G | RMB556.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215°C |
| storage temp. | Store at room temperature, keep dry and cool |
| solubility | H2O: soluble |
| form | Solid |
| color | White to off-white |
| Water Solubility | Soluble |
| InChI | InChI=1S/C8H6Cl2O3.Na/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1 |
| InChIKey | RFOHRSIAXQACDB-UHFFFAOYSA-M |
| SMILES | C1(OCC([O-])=O)C=CC(Cl)=CC=1Cl.[Na+] |
| CAS DataBase Reference | 2702-72-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-D sodium salt (2702-72-9) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-43-51/53 |
| Safety Statements | 24/25-26-36/37/39-46-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | AG8925000 |
| TSCA | TSCA listed |
| HS Code | 2909.30.6000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| REACH Registrations | Inactive |



