A3152912
Diantipyryl methane , AR , 1251-85-0
Synonym(s):
Diantipyrylmethane;Trichachnine monohydrate
CAS NO.:1251-85-0
Empirical Formula: C23H24N4O2
Molecular Weight: 388.46
MDL number: MFCD00003147
EINECS: 215-009-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB36.00 | In Stock |
|
| 100G | RMB118.40 | In Stock |
|
| 500g | RMB464.00 | In Stock |
|
| 2.5kg | RMB2140.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156 °C (dec.)(lit.) |
| Boiling point: | 514.17°C (rough estimate) |
| Density | 1.1960 (rough estimate) |
| bulk density | 430kg/m3 |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.431g/l (experimental) |
| pka | 1.26±0.65(Predicted) |
| form | powder to crystal |
| color | White |
| Water Solubility | 439mg/L(20 ºC) |
| BRN | 59702 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C23H24N4O2.H2O/c1-16-20(22(28)26(24(16)3)18-11-7-5-8-12-18)15-21-17(2)25(4)27(23(21)29)19-13-9-6-10-14-19;/h5-14H,15H2,1-4H3;1H2 |
| InChIKey | OSBQFBKEVMIGTJ-UHFFFAOYSA-N |
| SMILES | O.CN1N(C(=O)C(CC2=C(C)N(C)N(C2=O)c3ccccc3)=C1C)c4ccccc4 |
| CAS DataBase Reference | 1251-85-0(CAS DataBase Reference) |
| EPA Substance Registry System | 3H-Pyrazol-3-one, 4,4'-methylenebis[1,2-dihydro-1,5-dimethyl-2-phenyl- (1251-85-0) |
Description and Uses
Diantipyrylmethane is a chromogenic agent commonly used in spectrophotometry and extraction photometry for the determination of metals such as Au(III), Ti(IV), Ir, Fe(III), Mo, Nd, U(IV), Ir, Pt, and Re. Diantipyrylmethane is a kind of biological materials or organic compounds that are widely used in life science research[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |



