A3153712
4,4'-Diaminodiphenyl Sulfone , 97% , 80-08-0
Synonym(s):
DDS;Dapsone;Bis(4-aminophenyl) sulfone;4,4′-Diaminodiphenyl sulfone;4-Aminophenyl sulfone
CAS NO.:80-08-0
Empirical Formula: C12H12N2O2S
Molecular Weight: 248.3
MDL number: MFCD00007887
EINECS: 201-248-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 50g | RMB37.60 | In Stock |
|
| 100G | RMB48.80 | In Stock |
|
| 250g | RMB79.20 | In Stock |
|
| 500G | RMB148.00 | In Stock |
|
| 2.5kg | RMB604.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-177 °C(lit.) |
| Boiling point: | 511.7±35.0 °C(Predicted) |
| Density | 1.2701 (rough estimate) |
| bulk density | 250-350kg/m3 |
| vapor pressure | 0.004Pa at 25℃ |
| refractive index | 1.5950 (estimate) |
| storage temp. | 2-8°C |
| solubility | 0.38g/l |
| form | Crystalline Powder |
| pka | pKb 13.0(at 25℃) |
| color | White to beige |
| PH | 5.5-7.5 (H2O, 20℃)(saturated aqueous solution) |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| Merck | 14,2822 |
| BRN | 788055 |
| BCS Class | 4,2 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H12N2O2S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
| InChIKey | MQJKPEGWNLWLTK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)S(=O)(=O)c2ccc(N)cc2 |
| LogP | 0.97 at 25℃ |
| CAS DataBase Reference | 80-08-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Dapsone(80-08-0) |
| IARC | 3 (Vol. 24, Sup 7) 1987 |
| EPA Substance Registry System | Dapsone (80-08-0) |
Description and Uses
Hardening agent in the curing of epoxy resins.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H370-H373-H411 |
| Precautionary statements | P260-P264-P270-P273-P301+P312-P308+P311 |
| target organs | Blood, Blood,spleen,Liver |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22 |
| RIDADR | 3249 |
| WGK Germany | 1 |
| RTECS | BY8925000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29051620 |
| HS Code | 29309070 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Repr. 1B STOT RE 2 STOT SE 2 |
| Hazardous Substances Data | 80-08-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 1000 mg/kg LD50 dermal Rabbit > 4000 mg/kg |





