PRODUCT Properties
| Melting point: | -70 °C |
| Boiling point: | 165-167 °C/5 mmHg (lit.) |
| Density | 1.121 g/mL at 25 °C (lit.) |
| vapor density | 8.3 (vs air) |
| vapor pressure | 2.3 mm Hg ( 150 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 0.18g/l |
| form | Liquid |
| color | Clear colorless to light yellow |
| Odor | mild odor |
| Water Solubility | 6 g/L (20 ºC) |
| BRN | 1880877 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C14H14O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h3-8H,1-2,9-10H2 |
| InChIKey | QUDWYFHPNIMBFC-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)c1ccccc1C(=O)OCC=C |
| LogP | 3.23 at 20℃ |
| CAS DataBase Reference | 131-17-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenedicarboxylic acid, di-2-propenyl ester(131-17-9) |
| EPA Substance Registry System | Diallyl phthalate (131-17-9) |
Description and Uses
Diallyl Phthalate is used as a reagent in ring-closing ruthenium based reactions.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H317-H410 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 24/25-60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | CZ4200000 |
| F | 19 |
| Autoignition Temperature | 725 °F |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173400 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1B |
| Hazardous Substances Data | 131-17-9(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
