PRODUCT Properties
| Melting point: | -70 °C |
| Boiling point: | 165-167 °C/5 mmHg (lit.) |
| Density | 1.121 g/mL at 25 °C (lit.) |
| vapor density | 8.3 (vs air) |
| vapor pressure | 2.3 mm Hg ( 150 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 0.18g/l |
| form | Liquid |
| color | Clear colorless to light yellow |
| Odor | mild odor |
| Water Solubility | 6 g/L (20 ºC) |
| Thermal Conductivity | 0.305 W/(m·K) |
| BRN | 1880877 |
| Henry's Law Constant | 3.5×101 mol/(m3Pa) at 25℃, Sa\cc (2005) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C14H14O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h3-8H,1-2,9-10H2 |
| InChIKey | QUDWYFHPNIMBFC-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)c1ccccc1C(=O)OCC=C |
| LogP | 3.23 at 20℃ |
| CAS DataBase Reference | 131-17-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenedicarboxylic acid, di-2-propenyl ester(131-17-9) |
| EPA Substance Registry System | Diallyl phthalate (131-17-9) |
Description and Uses
Diallyl phthalate is a widely used crosslinking agent for unsaturated polyesters. Diallyl phthalate or diallyl phthalate polyester blends are used primarily as plasticizers and carriers for adding catalysts and pigments to polyesters and in molding, electrical parts, laminating compounds, and impregnation of metal castings. Rubber compounds, epoxy formulations, and polyurethane foams may also contain diallyl phthalate[1].
Diallyl Phthalate is used as a reagent in ring-closing ruthenium based reactions.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H317-H410 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 24/25-60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | CZ4200000 |
| F | 19 |
| Autoignition Temperature | 725 °F |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173400 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1B |
| Hazardous Substances Data | 131-17-9(Hazardous Substances Data) |
| REACH Registrations | Active |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
