A3156912
DMSO-d6 , D.99.9%+0.05%TMS , 2206-27-1
Synonym(s):
(Methyl sulfoxide)-d6;DMSO deuterated;DMSO-d6;Hexadeuterodimethyl sulfoxide
CAS NO.:2206-27-1
Empirical Formula: C2D6OS
Molecular Weight: 84.17
MDL number: MFCD00002090
EINECS: 218-617-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB183.20 | In Stock |
|
| 10G | RMB239.20 | In Stock |
|
| 10×1g | RMB279.20 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 50G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20.2 °C |
| Melting point: | 18,45°C |
| Boiling point: | 189°C |
| Boiling point: | 55 °C5 mm Hg(lit.) |
| Density | 1.190 g/mL at 25 °C(lit.) |
| Density | d = 1,19 |
| vapor pressure | 0.42 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | no restrictions. |
| solubility | Minimum isotopic purity 99.96% |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 1.190 |
| explosive limit | 1.8-63%(V) |
| Water Solubility | Miscible with water and with almost all organic solvents such as alcohols, esters, ketones, chlorinated solvents and aromatic hydrocarbons. |
| Sensitive | Hygroscopic |
| BRN | 1237248 |
| Stability: | Stable. Combustible. Moisture sensitive. Incompatible with acid chlorides, strong acids, phosphorus halides, strong oxidizing agents, strong reducing agents. Reacts violently with a wide range of materials - consult a full MSDS sheet before starting use. |
| InChI | 1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| InChIKey | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| LogP | -0.69 at 20℃ and pH7 |
| CAS DataBase Reference | 2206-27-1(CAS DataBase Reference) |
Description and Uses
DMSO-d6 is a solvent of choice in NMR spectroscopy, owing to its unique characteristics of dissolving both nonpolar and polar compounds, miscibility with almost all organic solvents and permitting high temperature dynamic NMR studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-23 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | PV6210000 |
| Autoignition Temperature | 573 °F |
| HS Code | 2845 90 10 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LD50 orally in Rabbit: 14500 mg/kg LD50 dermal Rat 40000 mg/kg |



