A3162912
Diphenyl phosphoryl azide , 97% , 26386-88-9
Synonym(s):
DPPA;12-Deoxyphorbol 13-phenylacetate 20-acetate;DPPA polymer-bound;Phosphoric acid diphenyl ester azide;PS-DPPA
CAS NO.:26386-88-9
Empirical Formula: C12H10N3O3P
Molecular Weight: 275.2
MDL number: MFCD00001987
EINECS: 247-644-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 500G | RMB406.40 | In Stock |
|
| 2.5kg | RMB1449.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 157 °C/0.17 mmHg (lit.) |
| Density | 1.277 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Sparingly) |
| form | Liquid |
| Specific Gravity | 1.277 |
| color | slightly yellow |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2058967 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| InChI | 1S/C12H10N3O3P/c13-14-15-19(16,17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10H |
| InChIKey | SORGEQQSQGNZFI-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NP(=O)(Oc1ccccc1)Oc2ccccc2 |
| CAS DataBase Reference | 26386-88-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylphosphoryl azide(26386-88-9) |
Description and Uses
Diphenylphosphoryl azide (DPPA or diphenyl phosphorazidate, (PhO)2P(O)N3) is a very toxic and potentially explosive organic compound. DPPA has been found to be effective for a variety of organic reactions as a versatile synthetic reagent. It is widely used in synthesis of other organic compounds especially as a reagent for the synthesis of peptides by virtue of its reactions with carboxylic acids leading to either the urethane or the amide.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3278 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Toxic/Keep Cold |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29299000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |





