3,3'-Diaminobenzidine , 97% , 91-95-2
Synonym(s):
3,3′,4,4′-Biphenyltetramine;3,3′,4,4′-Tetraaminobiphenyl;DAB;DAB tablets;Immunohistology substrate
CAS NO.:91-95-2
Empirical Formula: C12H14N4
Molecular Weight: 214.27
MDL number: MFCD00007725
EINECS: 202-110-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB298.40 | In Stock |
|
| 100G | RMB963.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 175-177 °C(lit.) |
| Boiling point: | 344.41°C (rough estimate) |
| Density | 1.1726 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| Flash point: | 12 °C |
| storage temp. | room temp |
| solubility | 0.55g/l |
| pka | 4.39±0.10(Predicted) |
| form | tablet |
| color | Crystals from MeOH |
| PH | 7 (1g/l, H2O, 20℃) |
| Water Solubility | 0.55 g/L (20 ºC) |
| Sensitive | Light Sensitive |
| BRN | 1212988 |
| Stability: | Moisture and light sensitive. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C12H14N4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H,13-16H2 |
| InChIKey | HSTOKWSFWGCZMH-UHFFFAOYSA-N |
| SMILES | NC1=C(N)C=CC(C2=CC(N)=C(N)C=C2)=C1 |
| CAS DataBase Reference | 91-95-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,3'-Diaminobenzidine(91-95-2) |
| EPA Substance Registry System | 3,3'-Diaminobenzidine (91-95-2) |
Description and Uses
3,3'-Diaminobenzidine (DAB) is a precursor to polybenzimidazole. DAB is frequently used in the immunohistochemical staining of nucleic acids and proteins. It can also be used to detect fingerprints in blood because that it can be oxidized by hydrogen peroxide in the presence of hemoglobin to give a dark-brown color.
3,3'-Diaminobenzidine is used as peroxidase substrate and a reagent for spectrophotometric determination of selenium. DAB is used for the immunohistochemical staining of nucleic acids and proteins. As a dark brown dye, was used as an antibody-specific stain to identify the paired antibodies in breast tissue. It may be used for the synthesis of a useful, linear, Schiff-base coordination polymer.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H319-H341-H350 |
| Precautionary statements | P202-P264-P270-P301+P312-P305+P351+P338-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,F,O |
| Risk Statements | 36/37/38-40-22-20/21/22-68-45-67-37-34-11-8 |
| Safety Statements | 26-36/37-45-36/37/39-22-53-16 |
| RIDADR | UN 3316 9 |
| WGK Germany | 1 |
| RTECS | DV8750000 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Muta. 2 |
| Toxicity | LDLo orl-rat: 3000 mg/kg CNREA8 26,619,66 |




