A3172056
(S)-2,4-Dichloro-α-(chloromethyl)benzylAlcohol , 98% , 126534-31-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB59.20 | In Stock |
|
| 100g | RMB220.00 | In Stock |
|
| 500g | RMB756.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62 °C |
| Boiling point: | 323.3±37.0 °C(Predicted) |
| Density | 1.447±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 12.45±0.20(Predicted) |
| color | White to Light yellow |
| optical activity | Consistent with structure |
| InChI | InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/s3 |
| InChIKey | XHEPANNURIQWRM-SBYBRXNCNA-N |
| SMILES | C1C=C([C@H](O)CCl)C(Cl)=CC=1Cl |&1:3,r| |
Description and Uses
(1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is a building block used in synthetic organic chemistry such as in the asymmetric chemoenzymatic synthesis of miconazole and econazole enantiomers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2906.29.6000 |




![(R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol](https://img.chemicalbook.com/CAS/GIF/127852-28-2.gif)


