A3172112
2,3-Dichlorobenzoic acid , 97% , 50-45-3
Synonym(s):
2,3-Dichlorobenzoic acid
CAS NO.:50-45-3
Empirical Formula: C7H4Cl2O2
Molecular Weight: 191.01
MDL number: MFCD00002413
EINECS: 200-039-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB202.40 | In Stock |
|
| 500g | RMB855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170 °C (lit.) |
| Boiling point: | 273.68°C (rough estimate) |
| Density | 1.4410 (rough estimate) |
| refractive index | 1.4590 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 2.53±0.25(Predicted) |
| form | solid |
| color | White to Off-White |
| Water Solubility | slightly soluble |
| BRN | 1946217 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11) |
| InChIKey | QAOJBHRZQQDFHA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1Cl |
| CAS DataBase Reference | 50-45-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2,3-Dichlorobenzoic acid (50-45-3) |
Description and Uses
2,3-Dichlorobenzoic acid is the key intermediate for antiepileptic drug Lamotrigine (L173250) and other pharmaceuticals for the treatment of central nervous system (CNS) disorders and disease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36-24/25 |
| WGK Germany | 2 |
| RTECS | DG6475000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![(Z)-[cyano(2,3-dichlorophenyl)methylene]carbazamidine](https://img.chemicalbook.com/CAS/GIF/94213-23-7.gif)


